![[ICO]](/icons/blank.gif){kind=icon}
![[DIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Ι.Μ. ΣΙΜΩΝΟΠΕΤΡΑ/ | 23-Jul-2008 22:44 | - | |
| 13 _It Is The Day Of Resurrection Let Us Be Radiant.._.m4a | 23-Jul-2008 22:39 | 13M | |
| Automela/ | 23-Jul-2008 22:43 | - | |
| CC_music/ | 23-Jul-2008 22:43 | - | |
| Dormition Dhoxasticon.mp3 | 23-Jul-2008 22:37 | 11M | |
| Eiselevsomai.pdf | 23-Jul-2008 22:35 | 327K | |
| Great Vespers.doc | 23-Jul-2008 22:35 | 72K | |
| Holy Week - Western Notation/ | 23-Jul-2008 22:40 | - | |
| Katavasia-Entrance.pdf | 23-Jul-2008 22:35 | 57K | |
| MW-Small Paraklesis Western Music.pdf | 23-Jul-2008 22:35 | 581K | |
| MW_Original_Melodies.pdf | 23-Jul-2008 22:35 | 1.8M | |
| Menaion/ | 23-Jul-2008 22:43 | - | |
| OchtoechosVespers.doc | 23-Jul-2008 22:34 | 294K | |
| Romeiko Ensemble/ | 23-Jul-2008 22:53 | - | |
| backup_stuffs/ | 15-Feb-2011 14:57 | - | |
| jan_27_1.pdf | 23-Jul-2008 22:35 | 31K | |
| jan_27_2.pdf | 23-Jul-2008 22:35 | 30K | |
| jan_27_3.pdf | 23-Jul-2008 22:35 | 30K | |